C2H4Li2O6S2 — CID 87246309
dilithium;ethane-1,2-disulfonate (PubChem CID 87246309) has the molecular formula C2H4Li2O6S2 and a molecular weight of 202.06 g/mol. Its IUPAC name is dilithium;ethane-1,2-disulfonate.
| Compound Name | dilithium;ethane-1,2-disulfonate |
|---|---|
| PubChem CID | 87246309 |
| Molecular Formula | C2H4Li2O6S2 |
| Molecular Weight | 202.06 g/mol |
| Exact Mass | 201.98 |
| IUPAC Name | dilithium;ethane-1,2-disulfonate |
| SMILES | O=S(=O)([O-])CCS(=O)(=O)[O-].[Li+].[Li+] |
| InChI | InChI=1S/C2H6O6S2.2Li/c3-9(4,5)1-2-10(6,7)8;;/h1-2H2,(H,3,4,5)(H,6,7,8);;/q;2*+1/p-2 |
| InChIKey | BBFXVAZBVHKUNK-UHFFFAOYSA-L |
| XLogP | -7.92 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.06 |
| LogP ≤ 5 | -7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|