C3H11NO3S3 — CID 3018766
azanium 2,3-bis(sulfanyl)propane-1-sulfonate (PubChem CID 3018766) has the molecular formula C3H11NO3S3 and a molecular weight of 205.33 g/mol. Its IUPAC name is azanium 2,3-bis(sulfanyl)propane-1-sulfonate.
| Compound Name | azanium 2,3-bis(sulfanyl)propane-1-sulfonate |
|---|---|
| PubChem CID | 3018766 |
| Molecular Formula | C3H11NO3S3 |
| Molecular Weight | 205.33 g/mol |
| Exact Mass | 204.99 |
| IUPAC Name | azanium 2,3-bis(sulfanyl)propane-1-sulfonate |
| SMILES | O=S(=O)([O-])CC(S)CS.[NH4+] |
| InChI | InChI=1S/C3H8O3S3.H3N/c4-9(5,6)2-3(8)1-7;/h3,7-8H,1-2H2,(H,4,5,6);1H3 |
| InChIKey | IEMMVNULOJVGIP-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.33 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|