C4H9KO4S — CID 59092896
potassium 2-hydroxybutane-1-sulfonate (PubChem CID 59092896) has the molecular formula C4H9KO4S and a molecular weight of 192.28 g/mol. Its IUPAC name is potassium 2-hydroxybutane-1-sulfonate.
| Compound Name | potassium 2-hydroxybutane-1-sulfonate |
|---|---|
| PubChem CID | 59092896 |
| Molecular Formula | C4H9KO4S |
| Molecular Weight | 192.28 g/mol |
| Exact Mass | 191.99 |
| IUPAC Name | potassium 2-hydroxybutane-1-sulfonate |
| SMILES | CCC(O)CS(=O)(=O)[O-].[K+] |
| InChI | InChI=1S/C4H10O4S.K/c1-2-4(5)3-9(6,7)8;/h4-5H,2-3H2,1H3,(H,6,7,8);/q;+1/p-1 |
| InChIKey | UASVPTGWGOMQMH-UHFFFAOYSA-M |
| XLogP | -3.69 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.28 |
| LogP ≤ 5 | -3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|