C8H15NaO6S — CID 162453586
sodium 2-hydroxy-3-(2-methylbutanoyloxy)propane-1-sulfonate (PubChem CID 162453586) has the molecular formula C8H15NaO6S and a molecular weight of 262.26 g/mol. Its IUPAC name is sodium 2-hydroxy-3-(2-methylbutanoyloxy)propane-1-sulfonate.
| Compound Name | sodium 2-hydroxy-3-(2-methylbutanoyloxy)propane-1-sulfonate |
|---|---|
| PubChem CID | 162453586 |
| Molecular Formula | C8H15NaO6S |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | sodium 2-hydroxy-3-(2-methylbutanoyloxy)propane-1-sulfonate |
| SMILES | CCC(C)C(=O)OCC(O)CS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C8H16O6S.Na/c1-3-6(2)8(10)14-4-7(9)5-15(11,12)13;/h6-7,9H,3-5H2,1-2H3,(H,11,12,13);/q;+1/p-1 |
| InChIKey | JORWGCFBXAPTDJ-UHFFFAOYSA-M |
| XLogP | -3.51 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | -3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|