About magnesium bis(3-hydroxypentanoate)
magnesium bis(3-hydroxypentanoate) (PubChem CID 164775085) has the molecular formula C10H18MgO6
and a molecular weight of 258.55 g/mol. Its IUPAC name is magnesium bis(3-hydroxypentanoate).
Molecular Properties
| Compound Name | magnesium bis(3-hydroxypentanoate) |
| PubChem CID | 164775085 |
| Molecular Formula | C10H18MgO6 |
| Molecular Weight | 258.55 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | magnesium bis(3-hydroxypentanoate) |
| SMILES | CCC(O)CC(=O)[O-].CCC(O)CC(=O)[O-].[Mg+2] |
| InChI | InChI=1S/2C5H10O3.Mg/c2*1-2-4(6)3-5(7)8;/h2*4,6H,2-3H2,1H3,(H,7,8);/q;;+2/p-2 |
| InChIKey | FLNXXXJXOVQHOX-UHFFFAOYSA-L |
| XLogP | -2.59 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.55 |
| LogP ≤ 5 | -2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze magnesium bis(3-hydroxypentanoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium bis(3-hydroxypentanoate)?
The IUPAC name of magnesium bis(3-hydroxypentanoate) (CID 164775085) is magnesium bis(3-hydroxypentanoate).
What is the SMILES notation for magnesium bis(3-hydroxypentanoate)?
The canonical SMILES for magnesium bis(3-hydroxypentanoate) is CCC(O)CC(=O)[O-].CCC(O)CC(=O)[O-].[Mg+2].
What is the InChIKey of magnesium bis(3-hydroxypentanoate)?
The InChIKey is FLNXXXJXOVQHOX-UHFFFAOYSA-L. The full InChI is InChI=1S/2C5H10O3.Mg/c2*1-2-4(6)3-5(7)8;/h2*4,6H,2-3H2,1H3,(H,7,8);/q;;+2/p-2.
What are the key properties of magnesium bis(3-hydroxypentanoate)?
magnesium bis(3-hydroxypentanoate) has a molecular weight of 258.55 g/mol, XLogP of -2.59, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium bis(3-hydroxypentanoate) is sourced from PubChem (CID 164775085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).