About potassium (3R)-3-hydroxybutanoate
potassium (3R)-3-hydroxybutanoate (PubChem CID 23704427) has the molecular formula C4H7KO3
and a molecular weight of 142.19 g/mol. Its IUPAC name is potassium (3R)-3-hydroxybutanoate.
Molecular Properties
| Compound Name | potassium (3R)-3-hydroxybutanoate |
| PubChem CID | 23704427 |
| Molecular Formula | C4H7KO3 |
| Molecular Weight | 142.19 g/mol |
| Exact Mass | 142.00 |
| IUPAC Name | potassium (3R)-3-hydroxybutanoate |
| SMILES | C[C@@H](O)CC(=O)[O-].[K+] |
| InChI | InChI=1S/C4H8O3.K/c1-3(5)2-4(6)7;/h3,5H,2H2,1H3,(H,6,7);/q;+1/p-1/t3-;/m1./s1 |
| InChIKey | CINYGFCEISABSR-AENDTGMFSA-M |
| XLogP | -4.49 |
| TPSA | 60.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.19 |
| LogP ≤ 5 | -4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze potassium (3R)-3-hydroxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium (3R)-3-hydroxybutanoate?
The IUPAC name of potassium (3R)-3-hydroxybutanoate (CID 23704427) is potassium (3R)-3-hydroxybutanoate.
What is the SMILES notation for potassium (3R)-3-hydroxybutanoate?
The canonical SMILES for potassium (3R)-3-hydroxybutanoate is C[C@@H](O)CC(=O)[O-].[K+].
What is the InChIKey of potassium (3R)-3-hydroxybutanoate?
The InChIKey is CINYGFCEISABSR-AENDTGMFSA-M. The full InChI is InChI=1S/C4H8O3.K/c1-3(5)2-4(6)7;/h3,5H,2H2,1H3,(H,6,7);/q;+1/p-1/t3-;/m1./s1.
What are the key properties of potassium (3R)-3-hydroxybutanoate?
potassium (3R)-3-hydroxybutanoate has a molecular weight of 142.19 g/mol, XLogP of -4.49, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium (3R)-3-hydroxybutanoate is sourced from PubChem (CID 23704427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).