potassium 4-hydroxy-2-oxopentanoate

C5H7KO4 — CID 169441902

IUPACpotassium 4-hydroxy-2-oxopentanoate
SMILESCC(O)CC(=O)C(=O)[O-].[K+]
InChIInChI=1S/C5H8O4.K/c1-3(6)2-4(7)5(8)9;/h3,6H,2H2,1H3,(H,8,9);/q;+1/p-1
InChIKeyUMKYHQKUABCGNK-UHFFFAOYSA-M
MW170.20 g/mol
LogP-4.92
Rot. Bonds3

About potassium 4-hydroxy-2-oxopentanoate

potassium 4-hydroxy-2-oxopentanoate (PubChem CID 169441902) has the molecular formula C5H7KO4 and a molecular weight of 170.20 g/mol. Its IUPAC name is potassium 4-hydroxy-2-oxopentanoate.

Molecular Properties

Compound Namepotassium 4-hydroxy-2-oxopentanoate
PubChem CID169441902
Molecular FormulaC5H7KO4
Molecular Weight170.20 g/mol
Exact Mass170.00
IUPAC Namepotassium 4-hydroxy-2-oxopentanoate
SMILESCC(O)CC(=O)C(=O)[O-].[K+]
InChIInChI=1S/C5H8O4.K/c1-3(6)2-4(7)5(8)9;/h3,6H,2H2,1H3,(H,8,9);/q;+1/p-1
InChIKeyUMKYHQKUABCGNK-UHFFFAOYSA-M
XLogP-4.92
TPSA77.43 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500170.20
LogP ≤ 5-4.92
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze potassium 4-hydroxy-2-oxopentanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium 4-hydroxy-2-oxopentanoate?
The IUPAC name of potassium 4-hydroxy-2-oxopentanoate (CID 169441902) is potassium 4-hydroxy-2-oxopentanoate.
What is the SMILES notation for potassium 4-hydroxy-2-oxopentanoate?
The canonical SMILES for potassium 4-hydroxy-2-oxopentanoate is CC(O)CC(=O)C(=O)[O-].[K+].
What is the InChIKey of potassium 4-hydroxy-2-oxopentanoate?
The InChIKey is UMKYHQKUABCGNK-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H8O4.K/c1-3(6)2-4(7)5(8)9;/h3,6H,2H2,1H3,(H,8,9);/q;+1/p-1.
What are the key properties of potassium 4-hydroxy-2-oxopentanoate?
potassium 4-hydroxy-2-oxopentanoate has a molecular weight of 170.20 g/mol, XLogP of -4.92, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 4-hydroxy-2-oxopentanoate is sourced from PubChem (CID 169441902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).