About 2-hydroxypropylazanium acetate
2-hydroxypropylazanium acetate (PubChem CID 22134549) has the molecular formula C5H13NO3
and a molecular weight of 135.16 g/mol. Its IUPAC name is 2-hydroxypropylazanium acetate.
Molecular Properties
| Compound Name | 2-hydroxypropylazanium acetate |
| PubChem CID | 22134549 |
| Molecular Formula | C5H13NO3 |
| Molecular Weight | 135.16 g/mol |
| Exact Mass | 135.09 |
| IUPAC Name | 2-hydroxypropylazanium acetate |
| SMILES | CC(=O)[O-].CC(O)C[NH3+] |
| InChI | InChI=1S/C3H9NO.C2H4O2/c1-3(5)2-4;1-2(3)4/h3,5H,2,4H2,1H3;1H3,(H,3,4) |
| InChIKey | PXSKFKIKNKEATE-UHFFFAOYSA-N |
| XLogP | -2.63 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.16 |
| LogP ≤ 5 | -2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-hydroxypropylazanium acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxypropylazanium acetate?
The IUPAC name of 2-hydroxypropylazanium acetate (CID 22134549) is 2-hydroxypropylazanium acetate.
What is the SMILES notation for 2-hydroxypropylazanium acetate?
The canonical SMILES for 2-hydroxypropylazanium acetate is CC(=O)[O-].CC(O)C[NH3+].
What is the InChIKey of 2-hydroxypropylazanium acetate?
The InChIKey is PXSKFKIKNKEATE-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9NO.C2H4O2/c1-3(5)2-4;1-2(3)4/h3,5H,2,4H2,1H3;1H3,(H,3,4).
What are the key properties of 2-hydroxypropylazanium acetate?
2-hydroxypropylazanium acetate has a molecular weight of 135.16 g/mol, XLogP of -2.63, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxypropylazanium acetate is sourced from PubChem (CID 22134549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).