C6H17NO4 — CID 160618134
methylazanium;propane-1,2-diol;acetate (PubChem CID 160618134) has the molecular formula C6H17NO4 and a molecular weight of 167.20 g/mol. Its IUPAC name is methylazanium;propane-1,2-diol;acetate.
| Compound Name | methylazanium;propane-1,2-diol;acetate |
|---|---|
| PubChem CID | 160618134 |
| Molecular Formula | C6H17NO4 |
| Molecular Weight | 167.20 g/mol |
| Exact Mass | 167.12 |
| IUPAC Name | methylazanium;propane-1,2-diol;acetate |
| SMILES | CC(=O)[O-].CC(O)CO.C[NH3+] |
| InChI | InChI=1S/C3H8O2.C2H4O2.CH5N/c1-3(5)2-4;1-2(3)4;1-2/h3-5H,2H2,1H3;1H3,(H,3,4);2H2,1H3 |
| InChIKey | AIRVNQQHOFHFNT-UHFFFAOYSA-N |
| XLogP | -3.03 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.20 |
| LogP ≤ 5 | -3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |