C10H14O6-2 — CID 22903088
(Z)-2,3-bis(2-hydroxypropyl)but-2-enedioate (PubChem CID 22903088) has the molecular formula C10H14O6-2 and a molecular weight of 230.22 g/mol. Its IUPAC name is (Z)-2,3-bis(2-hydroxypropyl)but-2-enedioate.
| Compound Name | (Z)-2,3-bis(2-hydroxypropyl)but-2-enedioate |
|---|---|
| PubChem CID | 22903088 |
| Molecular Formula | C10H14O6-2 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | (Z)-2,3-bis(2-hydroxypropyl)but-2-enedioate |
| SMILES | CC(O)C/C(C(=O)[O-])=C(\CC(C)O)C(=O)[O-] |
| InChI | InChI=1S/C10H16O6/c1-5(11)3-7(9(13)14)8(10(15)16)4-6(2)12/h5-6,11-12H,3-4H2,1-2H3,(H,13,14)(H,15,16)/p-2/b8-7- |
| InChIKey | ICWIMKJKBPFFBY-FPLPWBNLSA-L |
| XLogP | -2.68 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | -2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|