About dipotassium;2-methylbutanedioate
dipotassium;2-methylbutanedioate (PubChem CID 87067134) has the molecular formula C5H6K2O4
and a molecular weight of 208.29 g/mol. Its IUPAC name is dipotassium;2-methylbutanedioate.
Molecular Properties
| Compound Name | dipotassium;2-methylbutanedioate |
| PubChem CID | 87067134 |
| Molecular Formula | C5H6K2O4 |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 207.95 |
| IUPAC Name | dipotassium;2-methylbutanedioate |
| SMILES | CC(CC(=O)[O-])C(=O)[O-].[K+].[K+] |
| InChI | InChI=1S/C5H8O4.2K/c1-3(5(8)9)2-4(6)7;;/h3H,2H2,1H3,(H,6,7)(H,8,9);;/q;2*+1/p-2 |
| InChIKey | NTOJXABRPBNKOY-UHFFFAOYSA-L |
| XLogP | -8.48 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | -8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze dipotassium;2-methylbutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;2-methylbutanedioate?
The IUPAC name of dipotassium;2-methylbutanedioate (CID 87067134) is dipotassium;2-methylbutanedioate.
What is the SMILES notation for dipotassium;2-methylbutanedioate?
The canonical SMILES for dipotassium;2-methylbutanedioate is CC(CC(=O)[O-])C(=O)[O-].[K+].[K+].
What is the InChIKey of dipotassium;2-methylbutanedioate?
The InChIKey is NTOJXABRPBNKOY-UHFFFAOYSA-L. The full InChI is InChI=1S/C5H8O4.2K/c1-3(5(8)9)2-4(6)7;;/h3H,2H2,1H3,(H,6,7)(H,8,9);;/q;2*+1/p-2.
What are the key properties of dipotassium;2-methylbutanedioate?
dipotassium;2-methylbutanedioate has a molecular weight of 208.29 g/mol, XLogP of -8.48, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;2-methylbutanedioate is sourced from PubChem (CID 87067134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).