About butan-2-one;2-methyl-4-oxopentanoate;3-methyl-4-oxopentanoate;3-oxobutanoate
butan-2-one;2-methyl-4-oxopentanoate;3-methyl-4-oxopentanoate;3-oxobutanoate (PubChem CID 162054090) has the molecular formula C20H31O10-3
and a molecular weight of 431.46 g/mol. Its IUPAC name is butan-2-one;2-methyl-4-oxopentanoate;3-methyl-4-oxopentanoate;3-oxobutanoate.
Molecular Properties
| Compound Name | butan-2-one;2-methyl-4-oxopentanoate;3-methyl-4-oxopentanoate;3-oxobutanoate |
| PubChem CID | 162054090 |
| Molecular Formula | C20H31O10-3 |
| Molecular Weight | 431.46 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | butan-2-one;2-methyl-4-oxopentanoate;3-methyl-4-oxopentanoate;3-oxobutanoate |
| SMILES | CC(=O)C(C)CC(=O)[O-].CC(=O)CC(=O)[O-].CC(=O)CC(C)C(=O)[O-].CCC(C)=O |
| InChI | InChI=1S/2C6H10O3.C4H6O3.C4H8O/c1-4(5(2)7)3-6(8)9;1-4(6(8)9)3-5(2)7;1-3(5)2-4(6)7;1-3-4(2)5/h2*4H,3H2,1-2H3,(H,8,9);2H2,1H3,(H,6,7);3H2,1-2H3/p-3 |
| InChIKey | YYYCOKYGGFABOY-UHFFFAOYSA-K |
| XLogP | -1.60 |
| TPSA | 188.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.46 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze butan-2-one;2-methyl-4-oxopentanoate;3-methyl-4-oxopentanoate;3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-one;2-methyl-4-oxopentanoate;3-methyl-4-oxopentanoate;3-oxobutanoate?
The IUPAC name of butan-2-one;2-methyl-4-oxopentanoate;3-methyl-4-oxopentanoate;3-oxobutanoate (CID 162054090) is butan-2-one;2-methyl-4-oxopentanoate;3-methyl-4-oxopentanoate;3-oxobutanoate.
What is the SMILES notation for butan-2-one;2-methyl-4-oxopentanoate;3-methyl-4-oxopentanoate;3-oxobutanoate?
The canonical SMILES for butan-2-one;2-methyl-4-oxopentanoate;3-methyl-4-oxopentanoate;3-oxobutanoate is CC(=O)C(C)CC(=O)[O-].CC(=O)CC(=O)[O-].CC(=O)CC(C)C(=O)[O-].CCC(C)=O.
What is the InChIKey of butan-2-one;2-methyl-4-oxopentanoate;3-methyl-4-oxopentanoate;3-oxobutanoate?
The InChIKey is YYYCOKYGGFABOY-UHFFFAOYSA-K. The full InChI is InChI=1S/2C6H10O3.C4H6O3.C4H8O/c1-4(5(2)7)3-6(8)9;1-4(6(8)9)3-5(2)7;1-3(5)2-4(6)7;1-3-4(2)5/h2*4H,3H2,1-2H3,(H,8,9);2H2,1H3,(H,6,7);3H2,1-2H3/p-3.
What are the key properties of butan-2-one;2-methyl-4-oxopentanoate;3-methyl-4-oxopentanoate;3-oxobutanoate?
butan-2-one;2-methyl-4-oxopentanoate;3-methyl-4-oxopentanoate;3-oxobutanoate has a molecular weight of 431.46 g/mol, XLogP of -1.60, 9 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-one;2-methyl-4-oxopentanoate;3-methyl-4-oxopentanoate;3-oxobutanoate is sourced from PubChem (CID 162054090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).