C20H31O10-3 — CID 162054090
butan-2-one;2-methyl-4-oxopentanoate;3-methyl-4-oxopentanoate;3-oxobutanoate (PubChem CID 162054090) has the molecular formula C20H31O10-3 and a molecular weight of 431.46 g/mol. Its IUPAC name is butan-2-one;2-methyl-4-oxopentanoate;3-methyl-4-oxopentanoate;3-oxobutanoate.
| Compound Name | butan-2-one;2-methyl-4-oxopentanoate;3-methyl-4-oxopentanoate;3-oxobutanoate |
|---|---|
| PubChem CID | 162054090 |
| Molecular Formula | C20H31O10-3 |
| Molecular Weight | 431.46 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | butan-2-one;2-methyl-4-oxopentanoate;3-methyl-4-oxopentanoate;3-oxobutanoate |
| SMILES | CC(=O)C(C)CC(=O)[O-].CC(=O)CC(=O)[O-].CC(=O)CC(C)C(=O)[O-].CCC(C)=O |
| InChI | InChI=1S/2C6H10O3.C4H6O3.C4H8O/c1-4(5(2)7)3-6(8)9;1-4(6(8)9)3-5(2)7;1-3(5)2-4(6)7;1-3-4(2)5/h2*4H,3H2,1-2H3,(H,8,9);2H2,1H3,(H,6,7);3H2,1-2H3/p-3 |
| InChIKey | YYYCOKYGGFABOY-UHFFFAOYSA-K |
| XLogP | -1.60 |
| TPSA | 188.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.46 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|