C9H17NO2 — CID 178008293
3-(propan-2-ylamino)hexane-2,5-dione (PubChem CID 178008293) has the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is 3-(propan-2-ylamino)hexane-2,5-dione.
| Compound Name | 3-(propan-2-ylamino)hexane-2,5-dione |
|---|---|
| PubChem CID | 178008293 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | 3-(propan-2-ylamino)hexane-2,5-dione |
| SMILES | CC(=O)CC(NC(C)C)C(C)=O |
| InChI | InChI=1S/C9H17NO2/c1-6(2)10-9(8(4)12)5-7(3)11/h6,9-10H,5H2,1-4H3 |
| InChIKey | GTCIUBHIAYBBOI-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |