C9H15NO3 — CID 139449466
3-(2-oxopropylamino)hexane-2,5-dione (PubChem CID 139449466) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is 3-(2-oxopropylamino)hexane-2,5-dione.
| Compound Name | 3-(2-oxopropylamino)hexane-2,5-dione |
|---|---|
| PubChem CID | 139449466 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | 3-(2-oxopropylamino)hexane-2,5-dione |
| SMILES | CC(=O)CNC(CC(C)=O)C(C)=O |
| InChI | InChI=1S/C9H15NO3/c1-6(11)4-9(8(3)13)10-5-7(2)12/h9-10H,4-5H2,1-3H3 |
| InChIKey | RHJPQIOSQKXDRJ-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |