C20H36N2O6 — CID 118445194
diethyl 2-[[5-(2,5-dioxohexan-3-ylamino)-2-methylpentyl]amino]butanedioate (PubChem CID 118445194) has the molecular formula C20H36N2O6 and a molecular weight of 400.52 g/mol. Its IUPAC name is diethyl 2-[[5-(2,5-dioxohexan-3-ylamino)-2-methylpentyl]amino]butanedioate.
| Compound Name | diethyl 2-[[5-(2,5-dioxohexan-3-ylamino)-2-methylpentyl]amino]butanedioate |
|---|---|
| PubChem CID | 118445194 |
| Molecular Formula | C20H36N2O6 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | diethyl 2-[[5-(2,5-dioxohexan-3-ylamino)-2-methylpentyl]amino]butanedioate |
| SMILES | CCOC(=O)CC(NCC(C)CCCNC(CC(C)=O)C(C)=O)C(=O)OCC |
| InChI | InChI=1S/C20H36N2O6/c1-6-27-19(25)12-18(20(26)28-7-2)22-13-14(3)9-8-10-21-17(16(5)24)11-15(4)23/h14,17-18,21-22H,6-13H2,1-5H3 |
| InChIKey | OAQHVBWJLARZGU-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|