C22H45NO4P+ — CID 58912390
3-[(1,4-dihexoxy-1,4-dioxobutan-2-yl)amino]propyl-trimethylphosphanium (PubChem CID 58912390) has the molecular formula C22H45NO4P+ and a molecular weight of 418.58 g/mol. Its IUPAC name is 3-[(1,4-dihexoxy-1,4-dioxobutan-2-yl)amino]propyl-trimethylphosphanium.
| Compound Name | 3-[(1,4-dihexoxy-1,4-dioxobutan-2-yl)amino]propyl-trimethylphosphanium |
|---|---|
| PubChem CID | 58912390 |
| Molecular Formula | C22H45NO4P+ |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.31 |
| IUPAC Name | 3-[(1,4-dihexoxy-1,4-dioxobutan-2-yl)amino]propyl-trimethylphosphanium |
| SMILES | CCCCCCOC(=O)CC(NCCC[P+](C)(C)C)C(=O)OCCCCCC |
| InChI | InChI=1S/C22H45NO4P/c1-6-8-10-12-16-26-21(24)19-20(23-15-14-18-28(3,4)5)22(25)27-17-13-11-9-7-2/h20,23H,6-19H2,1-5H3/q+1 |
| InChIKey | LACJIEAUZXNXOM-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|