About calcium bis(3-methylbutanoate)
calcium bis(3-methylbutanoate) (PubChem CID 6453767) has the molecular formula C10H18CaO4
and a molecular weight of 242.33 g/mol. Its IUPAC name is calcium bis(3-methylbutanoate).
Molecular Properties
| Compound Name | calcium bis(3-methylbutanoate) |
| PubChem CID | 6453767 |
| Molecular Formula | C10H18CaO4 |
| Molecular Weight | 242.33 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | calcium bis(3-methylbutanoate) |
| SMILES | CC(C)CC(=O)[O-].CC(C)CC(=O)[O-].[Ca+2] |
| InChI | InChI=1S/2C5H10O2.Ca/c2*1-4(2)3-5(6)7;/h2*4H,3H2,1-2H3,(H,6,7);/q;;+2/p-2 |
| InChIKey | VYNQPZQRHJGOKI-UHFFFAOYSA-L |
| XLogP | -0.82 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.33 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze calcium bis(3-methylbutanoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium bis(3-methylbutanoate)?
The IUPAC name of calcium bis(3-methylbutanoate) (CID 6453767) is calcium bis(3-methylbutanoate).
What is the SMILES notation for calcium bis(3-methylbutanoate)?
The canonical SMILES for calcium bis(3-methylbutanoate) is CC(C)CC(=O)[O-].CC(C)CC(=O)[O-].[Ca+2].
What is the InChIKey of calcium bis(3-methylbutanoate)?
The InChIKey is VYNQPZQRHJGOKI-UHFFFAOYSA-L. The full InChI is InChI=1S/2C5H10O2.Ca/c2*1-4(2)3-5(6)7;/h2*4H,3H2,1-2H3,(H,6,7);/q;;+2/p-2.
What are the key properties of calcium bis(3-methylbutanoate)?
calcium bis(3-methylbutanoate) has a molecular weight of 242.33 g/mol, XLogP of -0.82, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for calcium bis(3-methylbutanoate) is sourced from PubChem (CID 6453767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).