About 3-methylbutanoate;toluene
3-methylbutanoate;toluene (PubChem CID 19842073) has the molecular formula C12H17O2-
and a molecular weight of 193.27 g/mol. Its IUPAC name is 3-methylbutanoate;toluene.
Molecular Properties
| Compound Name | 3-methylbutanoate;toluene |
| PubChem CID | 19842073 |
| Molecular Formula | C12H17O2- |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | 3-methylbutanoate;toluene |
| SMILES | CC(C)CC(=O)[O-].Cc1ccccc1 |
| InChI | InChI=1S/C7H8.C5H10O2/c1-7-5-3-2-4-6-7;1-4(2)3-5(6)7/h2-6H,1H3;4H,3H2,1-2H3,(H,6,7)/p-1 |
| InChIKey | XRBSEGDYCUGMJJ-UHFFFAOYSA-M |
| XLogP | 1.78 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methylbutanoate;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutanoate;toluene?
The IUPAC name of 3-methylbutanoate;toluene (CID 19842073) is 3-methylbutanoate;toluene.
What is the SMILES notation for 3-methylbutanoate;toluene?
The canonical SMILES for 3-methylbutanoate;toluene is CC(C)CC(=O)[O-].Cc1ccccc1.
What is the InChIKey of 3-methylbutanoate;toluene?
The InChIKey is XRBSEGDYCUGMJJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H8.C5H10O2/c1-7-5-3-2-4-6-7;1-4(2)3-5(6)7/h2-6H,1H3;4H,3H2,1-2H3,(H,6,7)/p-1.
What are the key properties of 3-methylbutanoate;toluene?
3-methylbutanoate;toluene has a molecular weight of 193.27 g/mol, XLogP of 1.78, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutanoate;toluene is sourced from PubChem (CID 19842073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).