C17H28O — CID 70503285
2,6-dimethylheptan-4-one;1,4-xylene (PubChem CID 70503285) has the molecular formula C17H28O and a molecular weight of 248.41 g/mol. Its IUPAC name is 2,6-dimethylheptan-4-one;1,4-xylene.
| Compound Name | 2,6-dimethylheptan-4-one;1,4-xylene |
|---|---|
| PubChem CID | 70503285 |
| Molecular Formula | C17H28O |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.21 |
| IUPAC Name | 2,6-dimethylheptan-4-one;1,4-xylene |
| SMILES | CC(C)CC(=O)CC(C)C.Cc1ccc(C)cc1 |
| InChI | InChI=1S/C9H18O.C8H10/c1-7(2)5-9(10)6-8(3)4;1-7-3-5-8(2)6-4-7/h7-8H,5-6H2,1-4H3;3-6H,1-2H3 |
| InChIKey | LZYUMLNVYUNTDC-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |