About 2,4-dimethylpentan-3-one;toluene
2,4-dimethylpentan-3-one;toluene (PubChem CID 68919843) has the molecular formula C14H22O
and a molecular weight of 206.33 g/mol. Its IUPAC name is 2,4-dimethylpentan-3-one;toluene.
Molecular Properties
| Compound Name | 2,4-dimethylpentan-3-one;toluene |
| PubChem CID | 68919843 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | 2,4-dimethylpentan-3-one;toluene |
| SMILES | CC(C)C(=O)C(C)C.Cc1ccccc1 |
| InChI | InChI=1S/C7H14O.C7H8/c1-5(2)7(8)6(3)4;1-7-5-3-2-4-6-7/h5-6H,1-4H3;2-6H,1H3 |
| InChIKey | UFPJGTMHEPUWOA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,4-dimethylpentan-3-one;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethylpentan-3-one;toluene?
The IUPAC name of 2,4-dimethylpentan-3-one;toluene (CID 68919843) is 2,4-dimethylpentan-3-one;toluene.
What is the SMILES notation for 2,4-dimethylpentan-3-one;toluene?
The canonical SMILES for 2,4-dimethylpentan-3-one;toluene is CC(C)C(=O)C(C)C.Cc1ccccc1.
What is the InChIKey of 2,4-dimethylpentan-3-one;toluene?
The InChIKey is UFPJGTMHEPUWOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O.C7H8/c1-5(2)7(8)6(3)4;1-7-5-3-2-4-6-7/h5-6H,1-4H3;2-6H,1H3.
What are the key properties of 2,4-dimethylpentan-3-one;toluene?
2,4-dimethylpentan-3-one;toluene has a molecular weight of 206.33 g/mol, XLogP of 3.86, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethylpentan-3-one;toluene is sourced from PubChem (CID 68919843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).