C11H18O3 — CID 141143930
2,8-dimethylnonane-4,5,6-trione (PubChem CID 141143930) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is 2,8-dimethylnonane-4,5,6-trione.
| Compound Name | 2,8-dimethylnonane-4,5,6-trione |
|---|---|
| PubChem CID | 141143930 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | 2,8-dimethylnonane-4,5,6-trione |
| SMILES | CC(C)CC(=O)C(=O)C(=O)CC(C)C |
| InChI | InChI=1S/C11H18O3/c1-7(2)5-9(12)11(14)10(13)6-8(3)4/h7-8H,5-6H2,1-4H3 |
| InChIKey | HAUUCKSMAHXFDA-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|