About sodium 6-methyl-4-oxoheptanoate
sodium 6-methyl-4-oxoheptanoate (PubChem CID 140787939) has the molecular formula C8H13NaO3
and a molecular weight of 180.18 g/mol. Its IUPAC name is sodium 6-methyl-4-oxoheptanoate.
Molecular Properties
| Compound Name | sodium 6-methyl-4-oxoheptanoate |
| PubChem CID | 140787939 |
| Molecular Formula | C8H13NaO3 |
| Molecular Weight | 180.18 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | sodium 6-methyl-4-oxoheptanoate |
| SMILES | CC(C)CC(=O)CCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C8H14O3.Na/c1-6(2)5-7(9)3-4-8(10)11;/h6H,3-5H2,1-2H3,(H,10,11);/q;+1/p-1 |
| InChIKey | IAHXPYBIGWNFNC-UHFFFAOYSA-M |
| XLogP | -2.86 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.18 |
| LogP ≤ 5 | -2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze sodium 6-methyl-4-oxoheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 6-methyl-4-oxoheptanoate?
The IUPAC name of sodium 6-methyl-4-oxoheptanoate (CID 140787939) is sodium 6-methyl-4-oxoheptanoate.
What is the SMILES notation for sodium 6-methyl-4-oxoheptanoate?
The canonical SMILES for sodium 6-methyl-4-oxoheptanoate is CC(C)CC(=O)CCC(=O)[O-].[Na+].
What is the InChIKey of sodium 6-methyl-4-oxoheptanoate?
The InChIKey is IAHXPYBIGWNFNC-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H14O3.Na/c1-6(2)5-7(9)3-4-8(10)11;/h6H,3-5H2,1-2H3,(H,10,11);/q;+1/p-1.
What are the key properties of sodium 6-methyl-4-oxoheptanoate?
sodium 6-methyl-4-oxoheptanoate has a molecular weight of 180.18 g/mol, XLogP of -2.86, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 6-methyl-4-oxoheptanoate is sourced from PubChem (CID 140787939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).