About bis(bis(2-methylpropyl)sulfanium);butanedioate
bis(bis(2-methylpropyl)sulfanium);butanedioate (PubChem CID 158915016) has the molecular formula C20H42O4S2
and a molecular weight of 410.69 g/mol. Its IUPAC name is bis(bis(2-methylpropyl)sulfanium);butanedioate.
Molecular Properties
| Compound Name | bis(bis(2-methylpropyl)sulfanium);butanedioate |
| PubChem CID | 158915016 |
| Molecular Formula | C20H42O4S2 |
| Molecular Weight | 410.69 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | bis(bis(2-methylpropyl)sulfanium);butanedioate |
| SMILES | CC(C)C[SH+]CC(C)C.CC(C)C[SH+]CC(C)C.O=C([O-])CCC(=O)[O-] |
| InChI | InChI=1S/2C8H18S.C4H6O4/c2*1-7(2)5-9-6-8(3)4;5-3(6)1-2-4(7)8/h2*7-8H,5-6H2,1-4H3;1-2H2,(H,5,6)(H,7,8) |
| InChIKey | JHCWDILSGDHJPK-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.69 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze bis(bis(2-methylpropyl)sulfanium);butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(bis(2-methylpropyl)sulfanium);butanedioate?
The IUPAC name of bis(bis(2-methylpropyl)sulfanium);butanedioate (CID 158915016) is bis(bis(2-methylpropyl)sulfanium);butanedioate.
What is the SMILES notation for bis(bis(2-methylpropyl)sulfanium);butanedioate?
The canonical SMILES for bis(bis(2-methylpropyl)sulfanium);butanedioate is CC(C)C[SH+]CC(C)C.CC(C)C[SH+]CC(C)C.O=C([O-])CCC(=O)[O-].
What is the InChIKey of bis(bis(2-methylpropyl)sulfanium);butanedioate?
The InChIKey is JHCWDILSGDHJPK-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H18S.C4H6O4/c2*1-7(2)5-9-6-8(3)4;5-3(6)1-2-4(7)8/h2*7-8H,5-6H2,1-4H3;1-2H2,(H,5,6)(H,7,8).
What are the key properties of bis(bis(2-methylpropyl)sulfanium);butanedioate?
bis(bis(2-methylpropyl)sulfanium);butanedioate has a molecular weight of 410.69 g/mol, XLogP of 1.49, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(bis(2-methylpropyl)sulfanium);butanedioate is sourced from PubChem (CID 158915016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).