C12H28O6S2-2 — CID 164995668
2-ethylbutane-1-sulfonate;methane;2-methylbutane-1-sulfonate (PubChem CID 164995668) has the molecular formula C12H28O6S2-2 and a molecular weight of 332.48 g/mol. Its IUPAC name is 2-ethylbutane-1-sulfonate;methane;2-methylbutane-1-sulfonate.
| Compound Name | 2-ethylbutane-1-sulfonate;methane;2-methylbutane-1-sulfonate |
|---|---|
| PubChem CID | 164995668 |
| Molecular Formula | C12H28O6S2-2 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 2-ethylbutane-1-sulfonate;methane;2-methylbutane-1-sulfonate |
| SMILES | C.CCC(C)CS(=O)(=O)[O-].CCC(CC)CS(=O)(=O)[O-] |
| InChI | InChI=1S/C6H14O3S.C5H12O3S.CH4/c1-3-6(4-2)5-10(7,8)9;1-3-5(2)4-9(6,7)8;/h6H,3-5H2,1-2H3,(H,7,8,9);5H,3-4H2,1-2H3,(H,6,7,8);1H4/p-2 |
| InChIKey | HNEXAHXOXGQRDP-UHFFFAOYSA-L |
| XLogP | 2.18 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|