C8H19NO2S — CID 97095663
(2R)-N-ethyl-N,2-dimethylbutane-1-sulfonamide (PubChem CID 97095663) has the molecular formula C8H19NO2S and a molecular weight of 193.31 g/mol. Its IUPAC name is (2R)-N-ethyl-N,2-dimethylbutane-1-sulfonamide.
| Compound Name | (2R)-N-ethyl-N,2-dimethylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 97095663 |
| Molecular Formula | C8H19NO2S |
| Molecular Weight | 193.31 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | (2R)-N-ethyl-N,2-dimethylbutane-1-sulfonamide |
| SMILES | CC[C@@H](C)CS(=O)(=O)N(C)CC |
| InChI | InChI=1S/C8H19NO2S/c1-5-8(3)7-12(10,11)9(4)6-2/h8H,5-7H2,1-4H3/t8-/m1/s1 |
| InChIKey | VDBHARPAZSMHOM-MRVPVSSYSA-N |
| XLogP | 1.31 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.31 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |