C8H15F3O2S — CID 130294591
(2R)-2-methyl-1-(3,3,3-trifluoropropylsulfonyl)butane (PubChem CID 130294591) has the molecular formula C8H15F3O2S and a molecular weight of 232.27 g/mol. Its IUPAC name is (2R)-2-methyl-1-(3,3,3-trifluoropropylsulfonyl)butane.
| Compound Name | (2R)-2-methyl-1-(3,3,3-trifluoropropylsulfonyl)butane |
|---|---|
| PubChem CID | 130294591 |
| Molecular Formula | C8H15F3O2S |
| Molecular Weight | 232.27 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | (2R)-2-methyl-1-(3,3,3-trifluoropropylsulfonyl)butane |
| SMILES | CC[C@@H](C)CS(=O)(=O)CCC(F)(F)F |
| InChI | InChI=1S/C8H15F3O2S/c1-3-7(2)6-14(12,13)5-4-8(9,10)11/h7H,3-6H2,1-2H3/t7-/m1/s1 |
| InChIKey | XAQWYCMSGQKJRI-SSDOTTSWSA-N |
| XLogP | 2.40 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.27 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |