C8H14BrF3O2S — CID 107747056
1-(2-bromo-3,3,3-trifluoropropyl)sulfonyl-2-methylbutane (PubChem CID 107747056) has the molecular formula C8H14BrF3O2S and a molecular weight of 311.16 g/mol. Its IUPAC name is 1-(2-bromo-3,3,3-trifluoropropyl)sulfonyl-2-methylbutane.
| Compound Name | 1-(2-bromo-3,3,3-trifluoropropyl)sulfonyl-2-methylbutane |
|---|---|
| PubChem CID | 107747056 |
| Molecular Formula | C8H14BrF3O2S |
| Molecular Weight | 311.16 g/mol |
| Exact Mass | 309.98 |
| IUPAC Name | 1-(2-bromo-3,3,3-trifluoropropyl)sulfonyl-2-methylbutane |
| SMILES | CCC(C)CS(=O)(=O)CC(Br)C(F)(F)F |
| InChI | InChI=1S/C8H14BrF3O2S/c1-3-6(2)4-15(13,14)5-7(9)8(10,11)12/h6-7H,3-5H2,1-2H3 |
| InChIKey | VQVXOYWLCHTVJK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.16 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|