C14H30O2S — CID 88834711
1-(2,3-dimethylpentylsulfonyl)-2,3-dimethylpentane (PubChem CID 88834711) has the molecular formula C14H30O2S and a molecular weight of 262.46 g/mol. Its IUPAC name is 1-(2,3-dimethylpentylsulfonyl)-2,3-dimethylpentane.
| Compound Name | 1-(2,3-dimethylpentylsulfonyl)-2,3-dimethylpentane |
|---|---|
| PubChem CID | 88834711 |
| Molecular Formula | C14H30O2S |
| Molecular Weight | 262.46 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | 1-(2,3-dimethylpentylsulfonyl)-2,3-dimethylpentane |
| SMILES | CCC(C)C(C)CS(=O)(=O)CC(C)C(C)CC |
| InChI | InChI=1S/C14H30O2S/c1-7-11(3)13(5)9-17(15,16)10-14(6)12(4)8-2/h11-14H,7-10H2,1-6H3 |
| InChIKey | CVEFEXNUTSJRBP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.46 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |