C10H22O2S — CID 166894384
2,3-dimethyl-1-propan-2-ylsulfonylpentane (PubChem CID 166894384) has the molecular formula C10H22O2S and a molecular weight of 206.35 g/mol. Its IUPAC name is 2,3-dimethyl-1-propan-2-ylsulfonylpentane.
| Compound Name | 2,3-dimethyl-1-propan-2-ylsulfonylpentane |
|---|---|
| PubChem CID | 166894384 |
| Molecular Formula | C10H22O2S |
| Molecular Weight | 206.35 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 2,3-dimethyl-1-propan-2-ylsulfonylpentane |
| SMILES | CCC(C)C(C)CS(=O)(=O)C(C)C |
| InChI | InChI=1S/C10H22O2S/c1-6-9(4)10(5)7-13(11,12)8(2)3/h8-10H,6-7H2,1-5H3 |
| InChIKey | QZXVYYOGDJWPHJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.35 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |