C10H22O4S2 — CID 172843003
2,3-dimethyl-1-(1-methylsulfonylpropylsulfonyl)butane (PubChem CID 172843003) has the molecular formula C10H22O4S2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 2,3-dimethyl-1-(1-methylsulfonylpropylsulfonyl)butane.
| Compound Name | 2,3-dimethyl-1-(1-methylsulfonylpropylsulfonyl)butane |
|---|---|
| PubChem CID | 172843003 |
| Molecular Formula | C10H22O4S2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 2,3-dimethyl-1-(1-methylsulfonylpropylsulfonyl)butane |
| SMILES | CCC(S(C)(=O)=O)S(=O)(=O)CC(C)C(C)C |
| InChI | InChI=1S/C10H22O4S2/c1-6-10(15(5,11)12)16(13,14)7-9(4)8(2)3/h8-10H,6-7H2,1-5H3 |
| InChIKey | XAYMJICMURVZLN-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |