About 2-methylsulfonylpropane
2-methylsulfonylpropane (PubChem CID 163990602) has the molecular formula C8H20O4S2
and a molecular weight of 244.38 g/mol. Its IUPAC name is 2-methylsulfonylpropane.
Molecular Properties
| Compound Name | 2-methylsulfonylpropane |
| PubChem CID | 163990602 |
| Molecular Formula | C8H20O4S2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 2-methylsulfonylpropane |
| SMILES | CC(C)S(C)(=O)=O.CC(C)S(C)(=O)=O |
| InChI | InChI=1S/2C4H10O2S/c2*1-4(2)7(3,5)6/h2*4H,1-3H3 |
| InChIKey | UAHLODCNBPBEPB-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methylsulfonylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfonylpropane?
The IUPAC name of 2-methylsulfonylpropane (CID 163990602) is 2-methylsulfonylpropane.
What is the SMILES notation for 2-methylsulfonylpropane?
The canonical SMILES for 2-methylsulfonylpropane is CC(C)S(C)(=O)=O.CC(C)S(C)(=O)=O.
What is the InChIKey of 2-methylsulfonylpropane?
The InChIKey is UAHLODCNBPBEPB-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H10O2S/c2*1-4(2)7(3,5)6/h2*4H,1-3H3.
What are the key properties of 2-methylsulfonylpropane?
2-methylsulfonylpropane has a molecular weight of 244.38 g/mol, XLogP of 0.88, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfonylpropane is sourced from PubChem (CID 163990602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).