C12H28F2 — CID 145386582
2,2-difluorobutane;ethane;3-methylpentane (PubChem CID 145386582) has the molecular formula C12H28F2 and a molecular weight of 210.35 g/mol. Its IUPAC name is 2,2-difluorobutane;ethane;3-methylpentane.
| Compound Name | 2,2-difluorobutane;ethane;3-methylpentane |
|---|---|
| PubChem CID | 145386582 |
| Molecular Formula | C12H28F2 |
| Molecular Weight | 210.35 g/mol |
| Exact Mass | 210.22 |
| IUPAC Name | 2,2-difluorobutane;ethane;3-methylpentane |
| SMILES | CC.CCC(C)(F)F.CCC(C)CC |
| InChI | InChI=1S/C6H14.C4H8F2.C2H6/c1-4-6(3)5-2;1-3-4(2,5)6;1-2/h6H,4-5H2,1-3H3;3H2,1-2H3;1-2H3 |
| InChIKey | DIXXBQKNAZGOMB-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.35 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |