C6H12F3NO2S — CID 81188635
1-(3,3,3-trifluoropropylsulfonyl)propan-2-amine (PubChem CID 81188635) has the molecular formula C6H12F3NO2S and a molecular weight of 219.23 g/mol. Its IUPAC name is 1-(3,3,3-trifluoropropylsulfonyl)propan-2-amine.
| Compound Name | 1-(3,3,3-trifluoropropylsulfonyl)propan-2-amine |
|---|---|
| PubChem CID | 81188635 |
| Molecular Formula | C6H12F3NO2S |
| Molecular Weight | 219.23 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | 1-(3,3,3-trifluoropropylsulfonyl)propan-2-amine |
| SMILES | CC(N)CS(=O)(=O)CCC(F)(F)F |
| InChI | InChI=1S/C6H12F3NO2S/c1-5(10)4-13(11,12)3-2-6(7,8)9/h5H,2-4,10H2,1H3 |
| InChIKey | GMPXPGHTAPXALF-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.23 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |