C8H16F3NO3S — CID 81188523
1-[3-(2,2,2-trifluoroethoxy)propylsulfonyl]propan-2-amine (PubChem CID 81188523) has the molecular formula C8H16F3NO3S and a molecular weight of 263.28 g/mol. Its IUPAC name is 1-[3-(2,2,2-trifluoroethoxy)propylsulfonyl]propan-2-amine.
| Compound Name | 1-[3-(2,2,2-trifluoroethoxy)propylsulfonyl]propan-2-amine |
|---|---|
| PubChem CID | 81188523 |
| Molecular Formula | C8H16F3NO3S |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 1-[3-(2,2,2-trifluoroethoxy)propylsulfonyl]propan-2-amine |
| SMILES | CC(N)CS(=O)(=O)CCCOCC(F)(F)F |
| InChI | InChI=1S/C8H16F3NO3S/c1-7(12)5-16(13,14)4-2-3-15-6-8(9,10)11/h7H,2-6,12H2,1H3 |
| InChIKey | IUEAJJDBZSMGDP-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|