C10H17F6NO5S3 — CID 126660464
1-(2-ethylsulfanylethoxy)-4,4-bis(trifluoromethylsulfonyl)butan-2-amine (PubChem CID 126660464) has the molecular formula C10H17F6NO5S3 and a molecular weight of 441.44 g/mol. Its IUPAC name is 1-(2-ethylsulfanylethoxy)-4,4-bis(trifluoromethylsulfonyl)butan-2-amine.
| Compound Name | 1-(2-ethylsulfanylethoxy)-4,4-bis(trifluoromethylsulfonyl)butan-2-amine |
|---|---|
| PubChem CID | 126660464 |
| Molecular Formula | C10H17F6NO5S3 |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.02 |
| IUPAC Name | 1-(2-ethylsulfanylethoxy)-4,4-bis(trifluoromethylsulfonyl)butan-2-amine |
| SMILES | CCSCCOCC(N)CC(S(=O)(=O)C(F)(F)F)S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C10H17F6NO5S3/c1-2-23-4-3-22-6-7(17)5-8(24(18,19)9(11,12)13)25(20,21)10(14,15)16/h7-8H,2-6,17H2,1H3 |
| InChIKey | QAEHZOFOURJIIJ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|