C10H19F4NO3S — CID 103474801
5-ethylsulfonyl-1-(2,2,3,3-tetrafluoropropoxy)pentan-2-amine (PubChem CID 103474801) has the molecular formula C10H19F4NO3S and a molecular weight of 309.33 g/mol. Its IUPAC name is 5-ethylsulfonyl-1-(2,2,3,3-tetrafluoropropoxy)pentan-2-amine.
| Compound Name | 5-ethylsulfonyl-1-(2,2,3,3-tetrafluoropropoxy)pentan-2-amine |
|---|---|
| PubChem CID | 103474801 |
| Molecular Formula | C10H19F4NO3S |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 5-ethylsulfonyl-1-(2,2,3,3-tetrafluoropropoxy)pentan-2-amine |
| SMILES | CCS(=O)(=O)CCCC(N)COCC(F)(F)C(F)F |
| InChI | InChI=1S/C10H19F4NO3S/c1-2-19(16,17)5-3-4-8(15)6-18-7-10(13,14)9(11)12/h8-9H,2-7,15H2,1H3 |
| InChIKey | YYYSHFISKHMWHG-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|