C7H12F4O2S — CID 2259897
1-(2,2,3,3-tetrafluoropropylsulfonyl)butane (PubChem CID 2259897) has the molecular formula C7H12F4O2S and a molecular weight of 236.23 g/mol. Its IUPAC name is 1-(2,2,3,3-tetrafluoropropylsulfonyl)butane.
| Compound Name | 1-(2,2,3,3-tetrafluoropropylsulfonyl)butane |
|---|---|
| PubChem CID | 2259897 |
| Molecular Formula | C7H12F4O2S |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | 1-(2,2,3,3-tetrafluoropropylsulfonyl)butane |
| SMILES | CCCCS(=O)(=O)CC(F)(F)C(F)F |
| InChI | InChI=1S/C7H12F4O2S/c1-2-3-4-14(12,13)5-7(10,11)6(8)9/h6H,2-5H2,1H3 |
| InChIKey | FLUNTZSBFAICPO-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|