C8H12F3NO2S — CID 103372441
2-(butylsulfonylmethyl)-3,3,3-trifluoropropanenitrile (PubChem CID 103372441) has the molecular formula C8H12F3NO2S and a molecular weight of 243.25 g/mol. Its IUPAC name is 2-(butylsulfonylmethyl)-3,3,3-trifluoropropanenitrile.
| Compound Name | 2-(butylsulfonylmethyl)-3,3,3-trifluoropropanenitrile |
|---|---|
| PubChem CID | 103372441 |
| Molecular Formula | C8H12F3NO2S |
| Molecular Weight | 243.25 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 2-(butylsulfonylmethyl)-3,3,3-trifluoropropanenitrile |
| SMILES | CCCCS(=O)(=O)CC(C#N)C(F)(F)F |
| InChI | InChI=1S/C8H12F3NO2S/c1-2-3-4-15(13,14)6-7(5-12)8(9,10)11/h7H,2-4,6H2,1H3 |
| InChIKey | RBHAQVWTQMMOQD-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.25 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |