C7H13F4NO2S — CID 106292109
N-(2-ethylsulfonylethyl)-2,2,3,3-tetrafluoropropan-1-amine (PubChem CID 106292109) has the molecular formula C7H13F4NO2S and a molecular weight of 251.24 g/mol. Its IUPAC name is N-(2-ethylsulfonylethyl)-2,2,3,3-tetrafluoropropan-1-amine.
| Compound Name | N-(2-ethylsulfonylethyl)-2,2,3,3-tetrafluoropropan-1-amine |
|---|---|
| PubChem CID | 106292109 |
| Molecular Formula | C7H13F4NO2S |
| Molecular Weight | 251.24 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | N-(2-ethylsulfonylethyl)-2,2,3,3-tetrafluoropropan-1-amine |
| SMILES | CCS(=O)(=O)CCNCC(F)(F)C(F)F |
| InChI | InChI=1S/C7H13F4NO2S/c1-2-15(13,14)4-3-12-5-7(10,11)6(8)9/h6,12H,2-5H2,1H3 |
| InChIKey | NNXJVBMBHDLIGQ-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.24 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|