C8H15F3N2O3S — CID 114110989
2-(2-ethylsulfonylethylamino)-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 114110989) has the molecular formula C8H15F3N2O3S and a molecular weight of 276.28 g/mol. Its IUPAC name is 2-(2-ethylsulfonylethylamino)-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-(2-ethylsulfonylethylamino)-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 114110989 |
| Molecular Formula | C8H15F3N2O3S |
| Molecular Weight | 276.28 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 2-(2-ethylsulfonylethylamino)-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | CCS(=O)(=O)CCNCC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C8H15F3N2O3S/c1-2-17(15,16)4-3-12-5-7(14)13-6-8(9,10)11/h12H,2-6H2,1H3,(H,13,14) |
| InChIKey | DRUDPZPTHSLMNX-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.28 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|