C7H11F3N2O3 — CID 43466550
3-[[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]amino]propanoic acid (PubChem CID 43466550) has the molecular formula C7H11F3N2O3 and a molecular weight of 228.17 g/mol. Its IUPAC name is 3-[[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]amino]propanoic acid.
| Compound Name | 3-[[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]amino]propanoic acid |
|---|---|
| PubChem CID | 43466550 |
| Molecular Formula | C7H11F3N2O3 |
| Molecular Weight | 228.17 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 3-[[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]amino]propanoic acid |
| SMILES | O=C(O)CCNCC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C7H11F3N2O3/c8-7(9,10)4-12-5(13)3-11-2-1-6(14)15/h11H,1-4H2,(H,12,13)(H,14,15) |
| InChIKey | GRQOAQJAJKERMT-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.17 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|