C11H21F3O3S — CID 160780783
2-methyl-7-(3,3,3-trifluoropropylsulfonyl)heptan-2-ol (PubChem CID 160780783) has the molecular formula C11H21F3O3S and a molecular weight of 290.35 g/mol. Its IUPAC name is 2-methyl-7-(3,3,3-trifluoropropylsulfonyl)heptan-2-ol.
| Compound Name | 2-methyl-7-(3,3,3-trifluoropropylsulfonyl)heptan-2-ol |
|---|---|
| PubChem CID | 160780783 |
| Molecular Formula | C11H21F3O3S |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 2-methyl-7-(3,3,3-trifluoropropylsulfonyl)heptan-2-ol |
| SMILES | CC(C)(O)CCCCCS(=O)(=O)CCC(F)(F)F |
| InChI | InChI=1S/C11H21F3O3S/c1-10(2,15)6-4-3-5-8-18(16,17)9-7-11(12,13)14/h15H,3-9H2,1-2H3 |
| InChIKey | SANVOWPPPYBUGI-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|