C15H32FNO2S — CID 159740001
4-(7-fluoro-7-methyloctyl)sulfonyl-N,N-dimethylbutan-1-amine (PubChem CID 159740001) has the molecular formula C15H32FNO2S and a molecular weight of 309.49 g/mol. Its IUPAC name is 4-(7-fluoro-7-methyloctyl)sulfonyl-N,N-dimethylbutan-1-amine.
| Compound Name | 4-(7-fluoro-7-methyloctyl)sulfonyl-N,N-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 159740001 |
| Molecular Formula | C15H32FNO2S |
| Molecular Weight | 309.49 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | 4-(7-fluoro-7-methyloctyl)sulfonyl-N,N-dimethylbutan-1-amine |
| SMILES | CN(C)CCCCS(=O)(=O)CCCCCCC(C)(C)F |
| InChI | InChI=1S/C15H32FNO2S/c1-15(2,16)11-7-5-6-9-13-20(18,19)14-10-8-12-17(3)4/h5-14H2,1-4H3 |
| InChIKey | VQDUAHICXHKSIG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.49 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|