C10H18F2N2O — CID 151847645
8-(dimethylamino)-4,4-difluorooct-2-enamide (PubChem CID 151847645) has the molecular formula C10H18F2N2O and a molecular weight of 220.26 g/mol. Its IUPAC name is 8-(dimethylamino)-4,4-difluorooct-2-enamide.
| Compound Name | 8-(dimethylamino)-4,4-difluorooct-2-enamide |
|---|---|
| PubChem CID | 151847645 |
| Molecular Formula | C10H18F2N2O |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | 8-(dimethylamino)-4,4-difluorooct-2-enamide |
| SMILES | CN(C)CCCCC(F)(F)C=CC(N)=O |
| InChI | InChI=1S/C10H18F2N2O/c1-14(2)8-4-3-6-10(11,12)7-5-9(13)15/h5,7H,3-4,6,8H2,1-2H3,(H2,13,15) |
| InChIKey | SHZPMMGTYPMKEG-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|