C13H30N4O — CID 55226399
2-amino-6-[3-(dimethylamino)propyl-methylamino]-2-methylhexanamide (PubChem CID 55226399) has the molecular formula C13H30N4O and a molecular weight of 258.41 g/mol. Its IUPAC name is 2-amino-6-[3-(dimethylamino)propyl-methylamino]-2-methylhexanamide.
| Compound Name | 2-amino-6-[3-(dimethylamino)propyl-methylamino]-2-methylhexanamide |
|---|---|
| PubChem CID | 55226399 |
| Molecular Formula | C13H30N4O |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.24 |
| IUPAC Name | 2-amino-6-[3-(dimethylamino)propyl-methylamino]-2-methylhexanamide |
| SMILES | CN(C)CCCN(C)CCCCC(C)(N)C(N)=O |
| InChI | InChI=1S/C13H30N4O/c1-13(15,12(14)18)8-5-6-10-17(4)11-7-9-16(2)3/h5-11,15H2,1-4H3,(H2,14,18) |
| InChIKey | WWVAOPVTLZSSKL-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|