C44H79F4NO4 — CID 167553141
bis[(Z)-5,5-difluorodec-3-en-2-yl] 9-[5-(dimethylamino)pentyl]heptadecanedioate (PubChem CID 167553141) has the molecular formula C44H79F4NO4 and a molecular weight of 762.11 g/mol. Its IUPAC name is bis[(Z)-5,5-difluorodec-3-en-2-yl] 9-[5-(dimethylamino)pentyl]heptadecanedioate.
| Compound Name | bis[(Z)-5,5-difluorodec-3-en-2-yl] 9-[5-(dimethylamino)pentyl]heptadecanedioate |
|---|---|
| PubChem CID | 167553141 |
| Molecular Formula | C44H79F4NO4 |
| Molecular Weight | 762.11 g/mol |
| Exact Mass | 761.59 |
| IUPAC Name | bis[(Z)-5,5-difluorodec-3-en-2-yl] 9-[5-(dimethylamino)pentyl]heptadecanedioate |
| SMILES | CCCCCC(F)(F)/C=C\C(C)OC(=O)CCCCCCCC(CCCCCCCC(=O)OC(C)/C=C\C(F)(F)CCCCC)CCCCCN(C)C |
| InChI | InChI=1S/C44H79F4NO4/c1-7-9-23-33-43(45,46)35-31-38(3)52-41(50)29-21-15-11-13-18-26-40(28-20-17-25-37-49(5)6)27-19-14-12-16-22-30-42(51)53-39(4)32-36-44(47,48)34-24-10-8-2/h31-32,35-36,38-40H,7-30,33-34,37H2,1-6H3/b35-31-,36-32- |
| InChIKey | BVDASPMHLBERML-XGHKFRFXSA-N |
| XLogP | 13.59 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.11 |
| LogP ≤ 5 | 13.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|