C8H12F6O2S — CID 87090137
1,1,1-trifluoro-4-(4,4,4-trifluorobutylsulfonyl)butane (PubChem CID 87090137) has the molecular formula C8H12F6O2S and a molecular weight of 286.24 g/mol. Its IUPAC name is 1,1,1-trifluoro-4-(4,4,4-trifluorobutylsulfonyl)butane.
| Compound Name | 1,1,1-trifluoro-4-(4,4,4-trifluorobutylsulfonyl)butane |
|---|---|
| PubChem CID | 87090137 |
| Molecular Formula | C8H12F6O2S |
| Molecular Weight | 286.24 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 1,1,1-trifluoro-4-(4,4,4-trifluorobutylsulfonyl)butane |
| SMILES | O=S(=O)(CCCC(F)(F)F)CCCC(F)(F)F |
| InChI | InChI=1S/C8H12F6O2S/c9-7(10,11)3-1-5-17(15,16)6-2-4-8(12,13)14/h1-6H2 |
| InChIKey | NVCBCPBPQGZSHQ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.24 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |