C8H22N2O3S — CID 141340656
1-aminoethanesulfonate;triethylazanium (PubChem CID 141340656) has the molecular formula C8H22N2O3S and a molecular weight of 226.34 g/mol. Its IUPAC name is 1-aminoethanesulfonate;triethylazanium.
| Compound Name | 1-aminoethanesulfonate;triethylazanium |
|---|---|
| PubChem CID | 141340656 |
| Molecular Formula | C8H22N2O3S |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | 1-aminoethanesulfonate;triethylazanium |
| SMILES | CC(N)S(=O)(=O)[O-].CC[NH+](CC)CC |
| InChI | InChI=1S/C6H15N.C2H7NO3S/c1-4-7(5-2)6-3;1-2(3)7(4,5)6/h4-6H2,1-3H3;2H,3H2,1H3,(H,4,5,6) |
| InChIKey | HGDXOZKBQPTWKA-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|