C10H16F9NO3S — CID 21470349
1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate;triethylazanium (PubChem CID 21470349) has the molecular formula C10H16F9NO3S and a molecular weight of 401.29 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate;triethylazanium.
| Compound Name | 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate;triethylazanium |
|---|---|
| PubChem CID | 21470349 |
| Molecular Formula | C10H16F9NO3S |
| Molecular Weight | 401.29 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate;triethylazanium |
| SMILES | CC[NH+](CC)CC.O=S(=O)([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C6H15N.C4HF9O3S/c1-4-7(5-2)6-3;5-1(6,3(9,10)11)2(7,8)4(12,13)17(14,15)16/h4-6H2,1-3H3;(H,14,15,16) |
| InChIKey | CKXILIWMLCYNIX-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 61.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.29 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|