C10H20F5NO3S — CID 165045362
1,1,4,4,4-pentafluorobutane-1-sulfonate;triethylazanium (PubChem CID 165045362) has the molecular formula C10H20F5NO3S and a molecular weight of 329.33 g/mol. Its IUPAC name is 1,1,4,4,4-pentafluorobutane-1-sulfonate;triethylazanium.
| Compound Name | 1,1,4,4,4-pentafluorobutane-1-sulfonate;triethylazanium |
|---|---|
| PubChem CID | 165045362 |
| Molecular Formula | C10H20F5NO3S |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 1,1,4,4,4-pentafluorobutane-1-sulfonate;triethylazanium |
| SMILES | CC[NH+](CC)CC.O=S(=O)([O-])C(F)(F)CCC(F)(F)F |
| InChI | InChI=1S/C6H15N.C4H5F5O3S/c1-4-7(5-2)6-3;5-3(6,7)1-2-4(8,9)13(10,11)12/h4-6H2,1-3H3;1-2H2,(H,10,11,12) |
| InChIKey | OURWTGVZBKJESS-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 61.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|